Name | Benzeneacetic acid, potassium salt |
Synonyms | Potassium phenylacetate POTASSIUM PHENYLACETATE Potassium 2-phenylacetate benzeneaceticacid,potassiumsalt PHENYLACETIC ACID POTASSIUM SALT Potassium Phenyl Acetate (Solid) Potassium Phenyl Acetate (Liquid) Benzeneacetic acid, potassium salt |
CAS | 13005-36-2 |
EINECS | 235-845-6 |
InChI | InChI=1/C8H8O2.K/c9-8(10)6-7-4-2-1-3-5-7;/h1-5H,6H2,(H,9,10);/q;+1/p-1 |
Molecular Formula | C8H7KO2 |
Molar Mass | 174.24 |
Use | For the production of pharmaceutical penicillin |
use | used in the production of pharmaceutical penicillin |
EPA chemical information | information provided by: ofmpub.epa.gov (external link) |